C28H31N5O5 — CID 140818300
tert-butyl 3-[5-ethoxycarbonyl-4-isocyano-3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 140818300) has the molecular formula C28H31N5O5 and a molecular weight of 517.59 g/mol. Its IUPAC name is tert-butyl 3-[5-ethoxycarbonyl-4-isocyano-3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-ethoxycarbonyl-4-isocyano-3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140818300 |
| Molecular Formula | C28H31N5O5 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | tert-butyl 3-[5-ethoxycarbonyl-4-isocyano-3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(-c2ccc(Oc3ccccc3)nc2)nn(C2CCCN(C(=O)OC(C)(C)C)C2)c1C(=O)OCC |
| InChI | InChI=1S/C28H31N5O5/c1-6-36-26(34)25-24(29-5)23(19-14-15-22(30-17-19)37-21-12-8-7-9-13-21)31-33(25)20-11-10-16-32(18-20)27(35)38-28(2,3)4/h7-9,12-15,17,20H,6,10-11,16,18H2,1-4H3 |
| InChIKey | MMSPWRAZTJLYSB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|