C26H28N6O3 — CID 138549596
5-amino-1-[(4S)-1-but-2-ynoylazocan-4-yl]-3-(6-phenoxy-3-pyridinyl)pyrazole-4-carboxamide (PubChem CID 138549596) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 5-amino-1-[(4S)-1-but-2-ynoylazocan-4-yl]-3-(6-phenoxy-3-pyridinyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(4S)-1-but-2-ynoylazocan-4-yl]-3-(6-phenoxy-3-pyridinyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138549596 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 5-amino-1-[(4S)-1-but-2-ynoylazocan-4-yl]-3-(6-phenoxy-3-pyridinyl)pyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CCCC[C@H](n2nc(-c3ccc(Oc4ccccc4)nc3)c(C(N)=O)c2N)CC1 |
| InChI | InChI=1S/C26H28N6O3/c1-2-8-22(33)31-15-7-6-9-19(14-16-31)32-25(27)23(26(28)34)24(30-32)18-12-13-21(29-17-18)35-20-10-4-3-5-11-20/h3-5,10-13,17,19H,6-7,9,14-16,27H2,1H3,(H2,28,34)/t19-/m0/s1 |
| InChIKey | HLNIVJNAOLSPAI-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|