C21H20ClFN6O3 — CID 126748810
5-amino-3-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]-1-[(3R)-1-formylpiperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 126748810) has the molecular formula C21H20ClFN6O3 and a molecular weight of 458.88 g/mol. Its IUPAC name is 5-amino-3-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]-1-[(3R)-1-formylpiperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]-1-[(3R)-1-formylpiperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 126748810 |
| Molecular Formula | C21H20ClFN6O3 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-amino-3-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]-1-[(3R)-1-formylpiperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ncc(Cl)cc3F)cc2)nn([C@@H]2CCCN(C=O)C2)c1N |
| InChI | InChI=1S/C21H20ClFN6O3/c22-13-8-16(23)21(26-9-13)32-15-5-3-12(4-6-15)18-17(20(25)31)19(24)29(27-18)14-2-1-7-28(10-14)11-30/h3-6,8-9,11,14H,1-2,7,10,24H2,(H2,25,31)/t14-/m1/s1 |
| InChIKey | JBBILWXBALMQSO-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|