C21H22F3N5O3 — CID 73052589
5-amino-1-(2-prop-2-enoyl-2-azaspiro[3.3]heptan-6-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 73052589) has the molecular formula C21H22F3N5O3 and a molecular weight of 449.43 g/mol. Its IUPAC name is 5-amino-1-(2-prop-2-enoyl-2-azaspiro[3.3]heptan-6-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(2-prop-2-enoyl-2-azaspiro[3.3]heptan-6-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 73052589 |
| Molecular Formula | C21H22F3N5O3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 5-amino-1-(2-prop-2-enoyl-2-azaspiro[3.3]heptan-6-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC2(CC(n3nc(-c4ccc(OCC(F)(F)F)cc4)c(C(N)=O)c3N)C2)C1 |
| InChI | InChI=1S/C21H22F3N5O3/c1-2-15(30)28-9-20(10-28)7-13(8-20)29-18(25)16(19(26)31)17(27-29)12-3-5-14(6-4-12)32-11-21(22,23)24/h2-6,13H,1,7-11,25H2,(H2,26,31) |
| InChIKey | MVORNYIPXRGSLG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|