C25H30F3N5O3 — CID 144571820
5-amino-N-methyl-1-(6-methyl-6-azaspiro[3.4]octan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide;but-2-ynal (PubChem CID 144571820) has the molecular formula C25H30F3N5O3 and a molecular weight of 505.54 g/mol. Its IUPAC name is 5-amino-N-methyl-1-(6-methyl-6-azaspiro[3.4]octan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide;but-2-ynal.
| Compound Name | 5-amino-N-methyl-1-(6-methyl-6-azaspiro[3.4]octan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide;but-2-ynal |
|---|---|
| PubChem CID | 144571820 |
| Molecular Formula | C25H30F3N5O3 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 5-amino-N-methyl-1-(6-methyl-6-azaspiro[3.4]octan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide;but-2-ynal |
| SMILES | CC#CC=O.CNC(=O)c1c(-c2ccc(OCC(F)(F)F)cc2)nn(C2CC3(CCN(C)C3)C2)c1N |
| InChI | InChI=1S/C21H26F3N5O2.C4H4O/c1-26-19(30)16-17(13-3-5-15(6-4-13)31-12-21(22,23)24)27-29(18(16)25)14-9-20(10-14)7-8-28(2)11-20;1-2-3-4-5/h3-6,14H,7-12,25H2,1-2H3,(H,26,30);4H,1H3 |
| InChIKey | NVNKHCGQTKLFNQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|