C24H28ClN5O3 — CID 144571631
5-amino-1-(2-but-2-ynoyl-2-azaspiro[3.3]heptan-6-yl)-3-(3-chloro-4-propoxyphenyl)-N-methylpyrazole-4-carboxamide (PubChem CID 144571631) has the molecular formula C24H28ClN5O3 and a molecular weight of 469.97 g/mol. Its IUPAC name is 5-amino-1-(2-but-2-ynoyl-2-azaspiro[3.3]heptan-6-yl)-3-(3-chloro-4-propoxyphenyl)-N-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(2-but-2-ynoyl-2-azaspiro[3.3]heptan-6-yl)-3-(3-chloro-4-propoxyphenyl)-N-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144571631 |
| Molecular Formula | C24H28ClN5O3 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5-amino-1-(2-but-2-ynoyl-2-azaspiro[3.3]heptan-6-yl)-3-(3-chloro-4-propoxyphenyl)-N-methylpyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CC2(CC(n3nc(-c4ccc(OCCC)c(Cl)c4)c(C(=O)NC)c3N)C2)C1 |
| InChI | InChI=1S/C24H28ClN5O3/c1-4-6-19(31)29-13-24(14-29)11-16(12-24)30-22(26)20(23(32)27-3)21(28-30)15-7-8-18(17(25)10-15)33-9-5-2/h7-8,10,16H,5,9,11-14,26H2,1-3H3,(H,27,32) |
| InChIKey | CSTBDYSEIWOVQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|