C24H27N5O3 — CID 73051625
5-amino-1-(6-but-2-ynoyl-6-azaspiro[3.4]octan-2-yl)-3-(4-cyclopropyloxyphenyl)pyrazole-4-carboxamide (PubChem CID 73051625) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 5-amino-1-(6-but-2-ynoyl-6-azaspiro[3.4]octan-2-yl)-3-(4-cyclopropyloxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(6-but-2-ynoyl-6-azaspiro[3.4]octan-2-yl)-3-(4-cyclopropyloxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 73051625 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 5-amino-1-(6-but-2-ynoyl-6-azaspiro[3.4]octan-2-yl)-3-(4-cyclopropyloxyphenyl)pyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CCC2(CC(n3nc(-c4ccc(OC5CC5)cc4)c(C(N)=O)c3N)C2)C1 |
| InChI | InChI=1S/C24H27N5O3/c1-2-3-19(30)28-11-10-24(14-28)12-16(13-24)29-22(25)20(23(26)31)21(27-29)15-4-6-17(7-5-15)32-18-8-9-18/h4-7,16,18H,8-14,25H2,1H3,(H2,26,31) |
| InChIKey | NFNYRDGSUPZOGG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|