C19H22F2N4O2 — CID 123530965
5-amino-3-[4-(2,2-difluorobut-3-enoxy)phenyl]-1-(3-methylcyclobutyl)pyrazole-4-carboxamide (PubChem CID 123530965) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-amino-3-[4-(2,2-difluorobut-3-enoxy)phenyl]-1-(3-methylcyclobutyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(2,2-difluorobut-3-enoxy)phenyl]-1-(3-methylcyclobutyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123530965 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-amino-3-[4-(2,2-difluorobut-3-enoxy)phenyl]-1-(3-methylcyclobutyl)pyrazole-4-carboxamide |
| SMILES | C=CC(F)(F)COc1ccc(-c2nn(C3CC(C)C3)c(N)c2C(N)=O)cc1 |
| InChI | InChI=1S/C19H22F2N4O2/c1-3-19(20,21)10-27-14-6-4-12(5-7-14)16-15(18(23)26)17(22)25(24-16)13-8-11(2)9-13/h3-7,11,13H,1,8-10,22H2,2H3,(H2,23,26) |
| InChIKey | ASFYSEZDOLKJPH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|