C21H23F4N5O2 — CID 144571714
5-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)pyrazole-4-carboxamide;prop-2-enal (PubChem CID 144571714) has the molecular formula C21H23F4N5O2 and a molecular weight of 453.44 g/mol. Its IUPAC name is 5-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)pyrazole-4-carboxamide;prop-2-enal.
| Compound Name | 5-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)pyrazole-4-carboxamide;prop-2-enal |
|---|---|
| PubChem CID | 144571714 |
| Molecular Formula | C21H23F4N5O2 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 5-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)pyrazole-4-carboxamide;prop-2-enal |
| SMILES | C=CC=O.CN1CC2(CC(n3nc(-c4ccc(F)c(C(F)(F)F)c4)c(C(N)=O)c3N)C2)C1 |
| InChI | InChI=1S/C18H19F4N5O.C3H4O/c1-26-7-17(8-26)5-10(6-17)27-15(23)13(16(24)28)14(25-27)9-2-3-12(19)11(4-9)18(20,21)22;1-2-3-4/h2-4,10H,5-8,23H2,1H3,(H2,24,28);2-3H,1H2 |
| InChIKey | PZOYAOFFHWFRHR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|