C24H24N6O5 — CID 118451826
5-amino-3-[4-(2-methyl-5-nitrophenoxy)phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide (PubChem CID 118451826) has the molecular formula C24H24N6O5 and a molecular weight of 476.49 g/mol. Its IUPAC name is 5-amino-3-[4-(2-methyl-5-nitrophenoxy)phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(2-methyl-5-nitrophenoxy)phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118451826 |
| Molecular Formula | C24H24N6O5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 5-amino-3-[4-(2-methyl-5-nitrophenoxy)phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(n2nc(-c3ccc(Oc4cc([N+](=O)[O-])ccc4C)cc3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C24H24N6O5/c1-3-20(31)28-11-10-17(13-28)29-23(25)21(24(26)32)22(27-29)15-5-8-18(9-6-15)35-19-12-16(30(33)34)7-4-14(19)2/h3-9,12,17H,1,10-11,13,25H2,2H3,(H2,26,32) |
| InChIKey | YXSCXSZZBVFFAT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 159.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|