C26H25F4N7O2 — CID 162605807
1-[(3aS)-2-but-2-ynoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-5-amino-3-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide (PubChem CID 162605807) has the molecular formula C26H25F4N7O2 and a molecular weight of 543.53 g/mol. Its IUPAC name is 1-[(3aS)-2-but-2-ynoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-5-amino-3-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[(3aS)-2-but-2-ynoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-5-amino-3-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162605807 |
| Molecular Formula | C26H25F4N7O2 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 1-[(3aS)-2-but-2-ynoyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-5-amino-3-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CC2CC(n3nc(-c4cnn(Cc5cc(C(F)(F)F)ccc5F)c4)c(C(N)=O)c3N)C[C@@H]2C1 |
| InChI | InChI=1S/C26H25F4N7O2/c1-2-3-21(38)35-10-14-7-19(8-15(14)11-35)37-24(31)22(25(32)39)23(34-37)17-9-33-36(13-17)12-16-6-18(26(28,29)30)4-5-20(16)27/h4-6,9,13-15,19H,7-8,10-12,31H2,1H3,(H2,32,39)/t14-,15?,19?/m1/s1 |
| InChIKey | MAFYLXIUIIPBLD-TZGCNFNXSA-N |
| XLogP | 3.07 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|