C13H15ClN4O3S — CID 163974561
[3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]phenyl]methyl methanesulfonate (PubChem CID 163974561) has the molecular formula C13H15ClN4O3S and a molecular weight of 342.81 g/mol. Its IUPAC name is [3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]phenyl]methyl methanesulfonate.
| Compound Name | [3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 163974561 |
| Molecular Formula | C13H15ClN4O3S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]phenyl]methyl methanesulfonate |
| SMILES | CNc1ncc(Cl)c(Nc2cccc(COS(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C13H15ClN4O3S/c1-15-13-16-7-11(14)12(18-13)17-10-5-3-4-9(6-10)8-21-22(2,19)20/h3-7H,8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | SSYDXXQMGRPNSY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|