C21H20ClF2N5O5S — CID 44526693
2-[[5-chloro-2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]-4,5-difluoro-N-methylbenzamide;formic acid (PubChem CID 44526693) has the molecular formula C21H20ClF2N5O5S and a molecular weight of 527.94 g/mol. Its IUPAC name is 2-[[5-chloro-2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]-4,5-difluoro-N-methylbenzamide;formic acid.
| Compound Name | 2-[[5-chloro-2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]-4,5-difluoro-N-methylbenzamide;formic acid |
|---|---|
| PubChem CID | 44526693 |
| Molecular Formula | C21H20ClF2N5O5S |
| Molecular Weight | 527.94 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 2-[[5-chloro-2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]-4,5-difluoro-N-methylbenzamide;formic acid |
| SMILES | CNC(=O)c1cc(F)c(F)cc1Nc1nc(Nc2cccc(CS(C)(=O)=O)c2)ncc1Cl.O=CO |
| InChI | InChI=1S/C20H18ClF2N5O3S.CH2O2/c1-24-19(29)13-7-15(22)16(23)8-17(13)27-18-14(21)9-25-20(28-18)26-12-5-3-4-11(6-12)10-32(2,30)31;2-1-3/h3-9H,10H2,1-2H3,(H,24,29)(H2,25,26,27,28);1H,(H,2,3) |
| InChIKey | LERYYSNNUZXWDX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|