C23H16F4N3O5+ — CID 163975680
[3-[[2-carboxy-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indol-1-yl]methyl]-4-fluorophenyl]-methoxy-oxoazanium (PubChem CID 163975680) has the molecular formula C23H16F4N3O5+ and a molecular weight of 490.39 g/mol. Its IUPAC name is [3-[[2-carboxy-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indol-1-yl]methyl]-4-fluorophenyl]-methoxy-oxoazanium.
| Compound Name | [3-[[2-carboxy-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indol-1-yl]methyl]-4-fluorophenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 163975680 |
| Molecular Formula | C23H16F4N3O5+ |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [3-[[2-carboxy-3-(2-oxo-1H-pyridin-3-yl)-5-(trifluoromethyl)indol-1-yl]methyl]-4-fluorophenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(F)c(Cn2c(C(=O)O)c(-c3ccc[nH]c3=O)c3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C23H15F4N3O5/c1-35-30(34)14-5-6-17(24)12(9-14)11-29-18-7-4-13(23(25,26)27)10-16(18)19(20(29)22(32)33)15-3-2-8-28-21(15)31/h2-10H,11H2,1H3,(H-,28,31,32,33)/p+1 |
| InChIKey | STXJAXMJRKTJBV-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|