C17H25NO2 — CID 163975824
(E,2R,6R)-7-methoxy-2-(5-methoxy-2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-6-methylhept-4-en-1-amine (PubChem CID 163975824) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (E,2R,6R)-7-methoxy-2-(5-methoxy-2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-6-methylhept-4-en-1-amine.
| Compound Name | (E,2R,6R)-7-methoxy-2-(5-methoxy-2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-6-methylhept-4-en-1-amine |
|---|---|
| PubChem CID | 163975824 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (E,2R,6R)-7-methoxy-2-(5-methoxy-2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-6-methylhept-4-en-1-amine |
| SMILES | COC[C@H](C)/C=C/C[C@@H](CN)C1=CC=C(OC)C2C=C12 |
| InChI | InChI=1S/C17H25NO2/c1-12(11-19-2)5-4-6-13(10-18)14-7-8-17(20-3)16-9-15(14)16/h4-5,7-9,12-13,16H,6,10-11,18H2,1-3H3/b5-4+/t12-,13+,16?/m1/s1 |
| InChIKey | SUALTVBISJZXIQ-HKHKWJBASA-N |
| XLogP | 2.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|