C10H20N2O2 — CID 163976215
(3R)-3-but-3-en-2-yl-2,5-dimethoxypiperazine (PubChem CID 163976215) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3R)-3-but-3-en-2-yl-2,5-dimethoxypiperazine.
| Compound Name | (3R)-3-but-3-en-2-yl-2,5-dimethoxypiperazine |
|---|---|
| PubChem CID | 163976215 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (3R)-3-but-3-en-2-yl-2,5-dimethoxypiperazine |
| SMILES | C=CC(C)[C@H]1NC(OC)CNC1OC |
| InChI | InChI=1S/C10H20N2O2/c1-5-7(2)9-10(14-4)11-6-8(12-9)13-3/h5,7-12H,1,6H2,2-4H3/t7?,8?,9-,10?/m1/s1 |
| InChIKey | SUJSNMDLWQZVCQ-OWTMBLHMSA-N |
| XLogP | 0.31 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|