C15H30N2O — CID 97231651
(2S,3S)-3-methyl-N-[(2S,3R)-3-morpholin-4-ylbutan-2-yl]hex-5-en-2-amine (PubChem CID 97231651) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (2S,3S)-3-methyl-N-[(2S,3R)-3-morpholin-4-ylbutan-2-yl]hex-5-en-2-amine.
| Compound Name | (2S,3S)-3-methyl-N-[(2S,3R)-3-morpholin-4-ylbutan-2-yl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 97231651 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (2S,3S)-3-methyl-N-[(2S,3R)-3-morpholin-4-ylbutan-2-yl]hex-5-en-2-amine |
| SMILES | C=CC[C@H](C)[C@H](C)N[C@@H](C)[C@@H](C)N1CCOCC1 |
| InChI | InChI=1S/C15H30N2O/c1-6-7-12(2)13(3)16-14(4)15(5)17-8-10-18-11-9-17/h6,12-16H,1,7-11H2,2-5H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | BOBYWLFRNUFRSU-ZQDZILKHSA-N |
| XLogP | 2.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|