C18H34N2O — CID 145472451
ethane;(4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine (PubChem CID 145472451) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is ethane;(4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine.
| Compound Name | ethane;(4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 145472451 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | ethane;(4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine |
| SMILES | C=C/C(=C\C=C/C)C(C)C(CN1CCOCC1)NC.CC |
| InChI | InChI=1S/C16H28N2O.C2H6/c1-5-7-8-15(6-2)14(3)16(17-4)13-18-9-11-19-12-10-18;1-2/h5-8,14,16-17H,2,9-13H2,1,3-4H3;1-2H3/b7-5-,15-8+; |
| InChIKey | LKJPLTSXXXIZPI-NVBXAWORSA-N |
| XLogP | 3.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|