C19H36N2O — CID 145472733
ethane;(5Z,6Z)-5-ethylidene-N,7-dimethyl-1-morpholin-4-ylnona-6,8-dien-2-amine (PubChem CID 145472733) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is ethane;(5Z,6Z)-5-ethylidene-N,7-dimethyl-1-morpholin-4-ylnona-6,8-dien-2-amine.
| Compound Name | ethane;(5Z,6Z)-5-ethylidene-N,7-dimethyl-1-morpholin-4-ylnona-6,8-dien-2-amine |
|---|---|
| PubChem CID | 145472733 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | ethane;(5Z,6Z)-5-ethylidene-N,7-dimethyl-1-morpholin-4-ylnona-6,8-dien-2-amine |
| SMILES | C=C/C(C)=C\C(=C/C)CCC(CN1CCOCC1)NC.CC |
| InChI | InChI=1S/C17H30N2O.C2H6/c1-5-15(3)13-16(6-2)7-8-17(18-4)14-19-9-11-20-12-10-19;1-2/h5-6,13,17-18H,1,7-12,14H2,2-4H3;1-2H3/b15-13-,16-6-; |
| InChIKey | WGKGFIZHTHLKEY-CMTMBDOFSA-N |
| XLogP | 3.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|