C18H30N2O — CID 142459371
N-[[1-[3-[(2Z)-2-ethenylpenta-2,4-dienyl]oxetan-3-yl]piperidin-4-yl]methyl]ethanamine (PubChem CID 142459371) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[[1-[3-[(2Z)-2-ethenylpenta-2,4-dienyl]oxetan-3-yl]piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[3-[(2Z)-2-ethenylpenta-2,4-dienyl]oxetan-3-yl]piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 142459371 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[[1-[3-[(2Z)-2-ethenylpenta-2,4-dienyl]oxetan-3-yl]piperidin-4-yl]methyl]ethanamine |
| SMILES | C=C/C=C(\C=C)CC1(N2CCC(CNCC)CC2)COC1 |
| InChI | InChI=1S/C18H30N2O/c1-4-7-16(5-2)12-18(14-21-15-18)20-10-8-17(9-11-20)13-19-6-3/h4-5,7,17,19H,1-2,6,8-15H2,3H3/b16-7+ |
| InChIKey | QYKGXELTZZXBKH-FRKPEAEDSA-N |
| XLogP | 2.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|