C16H28N2O — CID 145472452
(4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine (PubChem CID 145472452) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine.
| Compound Name | (4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 145472452 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (4E,6Z)-4-ethenyl-N,3-dimethyl-1-morpholin-4-ylocta-4,6-dien-2-amine |
| SMILES | C=C/C(=C\C=C/C)C(C)C(CN1CCOCC1)NC |
| InChI | InChI=1S/C16H28N2O/c1-5-7-8-15(6-2)14(3)16(17-4)13-18-9-11-19-12-10-18/h5-8,14,16-17H,2,9-13H2,1,3-4H3/b7-5-,15-8+ |
| InChIKey | HQUNSKFQXJHVOZ-VEQUYXNOSA-N |
| XLogP | 2.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|