C18H33Cl2N3O — CID 142172201
2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine;ethene (PubChem CID 142172201) has the molecular formula C18H33Cl2N3O and a molecular weight of 378.39 g/mol. Its IUPAC name is 2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine;ethene.
| Compound Name | 2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine;ethene |
|---|---|
| PubChem CID | 142172201 |
| Molecular Formula | C18H33Cl2N3O |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine;ethene |
| SMILES | C/C=C(Cl)\C(Cl)=C/CC(CN)CCNCCN1CCOCC1.C=C |
| InChI | InChI=1S/C16H29Cl2N3O.C2H4/c1-2-15(17)16(18)4-3-14(13-19)5-6-20-7-8-21-9-11-22-12-10-21;1-2/h2,4,14,20H,3,5-13,19H2,1H3;1-2H2/b15-2+,16-4+; |
| InChIKey | HYXDGMGZEFYHBM-ZYNRBBGESA-N |
| XLogP | 3.33 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|