C25H42N2O — CID 144858279
(4E,6E)-2-methyl-N-(1-morpholin-4-ylpropan-2-yl)-5,7-bis(prop-1-en-2-yl)undeca-2,4,6-trien-6-amine (PubChem CID 144858279) has the molecular formula C25H42N2O and a molecular weight of 386.62 g/mol. Its IUPAC name is (4E,6E)-2-methyl-N-(1-morpholin-4-ylpropan-2-yl)-5,7-bis(prop-1-en-2-yl)undeca-2,4,6-trien-6-amine.
| Compound Name | (4E,6E)-2-methyl-N-(1-morpholin-4-ylpropan-2-yl)-5,7-bis(prop-1-en-2-yl)undeca-2,4,6-trien-6-amine |
|---|---|
| PubChem CID | 144858279 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | (4E,6E)-2-methyl-N-(1-morpholin-4-ylpropan-2-yl)-5,7-bis(prop-1-en-2-yl)undeca-2,4,6-trien-6-amine |
| SMILES | C=C(C)C(=C\C=C(C)C)/C(NC(C)CN1CCOCC1)=C(/CCCC)C(=C)C |
| InChI | InChI=1S/C25H42N2O/c1-9-10-11-23(20(4)5)25(24(21(6)7)13-12-19(2)3)26-22(8)18-27-14-16-28-17-15-27/h12-13,22,26H,4,6,9-11,14-18H2,1-3,5,7-8H3/b24-13+,25-23+ |
| InChIKey | YYUNUGDSCKPQCN-OBYGDSCDSA-N |
| XLogP | 5.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|