C19H38N2O — CID 145473125
ethane;(5Z,6Z)-5-ethylidene-1-N-(2-methoxyethyl)-1-N,2-N,7-trimethylnona-6,8-diene-1,2-diamine (PubChem CID 145473125) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is ethane;(5Z,6Z)-5-ethylidene-1-N-(2-methoxyethyl)-1-N,2-N,7-trimethylnona-6,8-diene-1,2-diamine.
| Compound Name | ethane;(5Z,6Z)-5-ethylidene-1-N-(2-methoxyethyl)-1-N,2-N,7-trimethylnona-6,8-diene-1,2-diamine |
|---|---|
| PubChem CID | 145473125 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | ethane;(5Z,6Z)-5-ethylidene-1-N-(2-methoxyethyl)-1-N,2-N,7-trimethylnona-6,8-diene-1,2-diamine |
| SMILES | C=C/C(C)=C\C(=C/C)CCC(CN(C)CCOC)NC.CC |
| InChI | InChI=1S/C17H32N2O.C2H6/c1-7-15(3)13-16(8-2)9-10-17(18-4)14-19(5)11-12-20-6;1-2/h7-8,13,17-18H,1,9-12,14H2,2-6H3;1-2H3/b15-13-,16-8-; |
| InChIKey | DHTKRDMFSAEJDG-XFIVCHBASA-N |
| XLogP | 4.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|