C27H44N2O7 — CID 163976476
3-[2-[2-[[4-[(3-cycloheptyl-4-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoic acid (PubChem CID 163976476) has the molecular formula C27H44N2O7 and a molecular weight of 508.66 g/mol. Its IUPAC name is 3-[2-[2-[[4-[(3-cycloheptyl-4-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[[4-[(3-cycloheptyl-4-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 163976476 |
| Molecular Formula | C27H44N2O7 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 3-[2-[2-[[4-[(3-cycloheptyl-4-methyl-2,5-dioxopyrrolidin-1-yl)methyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoic acid |
| SMILES | CC1C(=O)N(CC2CCC(C(=O)NCCOCCOCCC(=O)O)CC2)C(=O)C1C1CCCCCC1 |
| InChI | InChI=1S/C27H44N2O7/c1-19-24(21-6-4-2-3-5-7-21)27(34)29(26(19)33)18-20-8-10-22(11-9-20)25(32)28-13-15-36-17-16-35-14-12-23(30)31/h19-22,24H,2-18H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | SUOWITCQJRXTIJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|