C17H30N4O4 — CID 163977516
N-(5-acetamidononyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetamide (PubChem CID 163977516) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(5-acetamidononyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetamide.
| Compound Name | N-(5-acetamidononyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetamide |
|---|---|
| PubChem CID | 163977516 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N-(5-acetamidononyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]acetamide |
| SMILES | CCCCC(CCCCNC(=O)COCc1nc(C)no1)NC(C)=O |
| InChI | InChI=1S/C17H30N4O4/c1-4-5-8-15(20-14(3)22)9-6-7-10-18-16(23)11-24-12-17-19-13(2)21-25-17/h15H,4-12H2,1-3H3,(H,18,23)(H,20,22) |
| InChIKey | SVMDNVPZNFUPIC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|