C26H24F4N2O3S — CID 163978836
(6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-8-fluoro-5-(3-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline (PubChem CID 163978836) has the molecular formula C26H24F4N2O3S and a molecular weight of 520.55 g/mol. Its IUPAC name is (6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-8-fluoro-5-(3-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline.
| Compound Name | (6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-8-fluoro-5-(3-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 163978836 |
| Molecular Formula | C26H24F4N2O3S |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-8-fluoro-5-(3-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline |
| SMILES | Cc1cccc(S(=O)(=O)N2C[C@@H]3CC(F)CCN3c3ccc(-c4cc(F)cc(OC(F)F)c4)cc32)c1 |
| InChI | InChI=1S/C26H24F4N2O3S/c1-16-3-2-4-23(9-16)36(33,34)32-15-21-13-19(27)7-8-31(21)24-6-5-17(12-25(24)32)18-10-20(28)14-22(11-18)35-26(29)30/h2-6,9-12,14,19,21,26H,7-8,13,15H2,1H3/t19?,21-/m0/s1 |
| InChIKey | JHOKLGWQKAIWJM-QWAKEFERSA-N |
| XLogP | 5.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |