C26H22F6N2O4S — CID 154658488
(6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol (PubChem CID 154658488) has the molecular formula C26H22F6N2O4S and a molecular weight of 572.53 g/mol. Its IUPAC name is (6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol.
| Compound Name | (6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol |
|---|---|
| PubChem CID | 154658488 |
| Molecular Formula | C26H22F6N2O4S |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | (6aS)-3-[3-(difluoromethoxy)-5-fluorophenyl]-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1C[C@@H]2CC(O)CCN2c2ccc(-c3cc(F)cc(OC(F)F)c3)cc21 |
| InChI | InChI=1S/C26H22F6N2O4S/c27-18-8-16(9-21(12-18)38-25(28)29)15-4-5-23-24(10-15)34(14-19-13-20(35)6-7-33(19)23)39(36,37)22-3-1-2-17(11-22)26(30,31)32/h1-5,8-12,19-20,25,35H,6-7,13-14H2/t19-,20?/m0/s1 |
| InChIKey | AWQMDUXVMUGRNO-XJDOXCRVSA-N |
| XLogP | 5.65 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |