C19H18BrF3N2O3S — CID 154658494
(6aS)-3-bromo-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol (PubChem CID 154658494) has the molecular formula C19H18BrF3N2O3S and a molecular weight of 491.33 g/mol. Its IUPAC name is (6aS)-3-bromo-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol.
| Compound Name | (6aS)-3-bromo-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol |
|---|---|
| PubChem CID | 154658494 |
| Molecular Formula | C19H18BrF3N2O3S |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | (6aS)-3-bromo-5-[3-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-8-ol |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1C[C@@H]2CC(O)CCN2c2ccc(Br)cc21 |
| InChI | InChI=1S/C19H18BrF3N2O3S/c20-13-4-5-17-18(9-13)25(11-14-10-15(26)6-7-24(14)17)29(27,28)16-3-1-2-12(8-16)19(21,22)23/h1-5,8-9,14-15,26H,6-7,10-11H2/t14-,15?/m0/s1 |
| InChIKey | KKLGUWAYBIAZRK-MLCCFXAWSA-N |
| XLogP | 4.01 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |