C11H14F3N — CID 163979425
N-[(E)-4,4,4-trifluoro-3-[(2-methylcycloprop-2-en-1-yl)methyl]but-2-en-2-yl]ethanimine (PubChem CID 163979425) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is N-[(E)-4,4,4-trifluoro-3-[(2-methylcycloprop-2-en-1-yl)methyl]but-2-en-2-yl]ethanimine.
| Compound Name | N-[(E)-4,4,4-trifluoro-3-[(2-methylcycloprop-2-en-1-yl)methyl]but-2-en-2-yl]ethanimine |
|---|---|
| PubChem CID | 163979425 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[(E)-4,4,4-trifluoro-3-[(2-methylcycloprop-2-en-1-yl)methyl]but-2-en-2-yl]ethanimine |
| SMILES | C/C=N/C(C)=C(\CC1C=C1C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N/c1-4-15-8(3)10(11(12,13)14)6-9-5-7(9)2/h4-5,9H,6H2,1-3H3/b10-8+,15-4+ |
| InChIKey | SXBKPMBYEXCCMP-QQCXGBIESA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|