About (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate
(4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 163980235) has the molecular formula C26H40O2
and a molecular weight of 384.60 g/mol. Its IUPAC name is (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 163980235 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)C1C2CC(CC2C(=O)OC2(C)C3CC4CC5CC2C53C4)C1C(C)(C)C |
| InChI | InChI=1S/C26H40O2/c1-13(2)21-17-9-15(22(21)24(3,4)5)10-18(17)23(27)28-25(6)19-8-14-7-16-11-20(25)26(16,19)12-14/h13-22H,7-12H2,1-6H3 |
| InChIKey | SXSPYYDAMDVHIB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate (CID 163980235) is (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate is CC(C)C1C2CC(CC2C(=O)OC2(C)C3CC4CC5CC2C53C4)C1C(C)(C)C.
What is the InChIKey of (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is SXSPYYDAMDVHIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40O2/c1-13(2)21-17-9-15(22(21)24(3,4)5)10-18(17)23(27)28-25(6)19-8-14-7-16-11-20(25)26(16,19)12-14/h13-22H,7-12H2,1-6H3.
What are the key properties of (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate?
(4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 384.60 g/mol, XLogP of 5.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-4-tetracyclo[5.2.1.03,8.05,8]decanyl) 5-tert-butyl-6-propan-2-ylbicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 163980235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).