C15H25NO3 — CID 163981172
(9-imino-7-oxoundecyl) 2-methylprop-2-enoate (PubChem CID 163981172) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (9-imino-7-oxoundecyl) 2-methylprop-2-enoate.
| Compound Name | (9-imino-7-oxoundecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163981172 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (9-imino-7-oxoundecyl) 2-methylprop-2-enoate |
| SMILES | [H]/N=C(\CC)CC(=O)CCCCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C15H25NO3/c1-4-13(16)11-14(17)9-7-5-6-8-10-19-15(18)12(2)3/h16H,2,4-11H2,1,3H3/b16-13+ |
| InChIKey | SYMLNLQBHNSLDE-DTQAZKPQSA-N |
| XLogP | 3.45 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|