C42H40BN3O2 — CID 163981178
3-[[9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazol-2-yl]-methylboranyl]oxy-2,3-dimethylbutan-2-ol (PubChem CID 163981178) has the molecular formula C42H40BN3O2 and a molecular weight of 629.61 g/mol. Its IUPAC name is 3-[[9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazol-2-yl]-methylboranyl]oxy-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[[9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazol-2-yl]-methylboranyl]oxy-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 163981178 |
| Molecular Formula | C42H40BN3O2 |
| Molecular Weight | 629.61 g/mol |
| Exact Mass | 629.32 |
| IUPAC Name | 3-[[9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazol-2-yl]-methylboranyl]oxy-2,3-dimethylbutan-2-ol |
| SMILES | CB(OC(C)(C)C(C)(C)O)c1ccc2c3ccccc3n(-c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccc4n3)c2c1 |
| InChI | InChI=1S/C42H40BN3O2/c1-40(2)33-17-11-8-14-28(33)29-22-20-26(24-34(29)40)38-32-16-9-12-18-35(32)44-39(45-38)46-36-19-13-10-15-30(36)31-23-21-27(25-37(31)46)43(7)48-42(5,6)41(3,4)47/h8-25,47H,1-7H3 |
| InChIKey | SYMPAHHOPQVHRZ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.61 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|