C41H30BN3O2 — CID 67701227
[11,11-dimethyl-5-[4-(4-phenylphenyl)quinazolin-2-yl]indeno[1,2-b]carbazol-2-yl]boronic acid (PubChem CID 67701227) has the molecular formula C41H30BN3O2 and a molecular weight of 607.52 g/mol. Its IUPAC name is [11,11-dimethyl-5-[4-(4-phenylphenyl)quinazolin-2-yl]indeno[1,2-b]carbazol-2-yl]boronic acid.
| Compound Name | [11,11-dimethyl-5-[4-(4-phenylphenyl)quinazolin-2-yl]indeno[1,2-b]carbazol-2-yl]boronic acid |
|---|---|
| PubChem CID | 67701227 |
| Molecular Formula | C41H30BN3O2 |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | [11,11-dimethyl-5-[4-(4-phenylphenyl)quinazolin-2-yl]indeno[1,2-b]carbazol-2-yl]boronic acid |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)c1cc(B(O)O)ccc1n3-c1nc(-c2ccc(-c3ccccc3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C41H30BN3O2/c1-41(2)34-14-8-6-12-29(34)31-24-38-33(23-35(31)41)32-22-28(42(46)47)20-21-37(32)45(38)40-43-36-15-9-7-13-30(36)39(44-40)27-18-16-26(17-19-27)25-10-4-3-5-11-25/h3-24,46-47H,1-2H3 |
| InChIKey | ZWVNLIDRMBZKLA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|