C10H16F2N2O2 — CID 163981352
2-[1-(2,2-difluoroethyl)pyrazol-4-yl]pentane-1,5-diol (PubChem CID 163981352) has the molecular formula C10H16F2N2O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[1-(2,2-difluoroethyl)pyrazol-4-yl]pentane-1,5-diol.
| Compound Name | 2-[1-(2,2-difluoroethyl)pyrazol-4-yl]pentane-1,5-diol |
|---|---|
| PubChem CID | 163981352 |
| Molecular Formula | C10H16F2N2O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-[1-(2,2-difluoroethyl)pyrazol-4-yl]pentane-1,5-diol |
| SMILES | OCCCC(CO)c1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C10H16F2N2O2/c11-10(12)6-14-5-9(4-13-14)8(7-16)2-1-3-15/h4-5,8,10,15-16H,1-3,6-7H2 |
| InChIKey | SYQQIWFJWLAWFL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |