C10H15F3N2O2 — CID 135352089
(3R)-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)pentane-1,5-diol (PubChem CID 135352089) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is (3R)-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)pentane-1,5-diol.
| Compound Name | (3R)-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 135352089 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (3R)-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)pentane-1,5-diol |
| SMILES | Cn1cc(C(O)C[C@@H](CCO)C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H15F3N2O2/c1-15-6-7(5-14-15)9(17)4-8(2-3-16)10(11,12)13/h5-6,8-9,16-17H,2-4H2,1H3/t8-,9?/m1/s1 |
| InChIKey | GYTWZDPJPAHEII-VEDVMXKPSA-N |
| XLogP | 1.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |