C13H18F2N2O2 — CID 163383978
(3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol (PubChem CID 163383978) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol.
| Compound Name | (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 163383978 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol |
| SMILES | OC(c1cnn(C2CCCCO2)c1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H18F2N2O2/c14-13(15)5-9(6-13)12(18)10-7-16-17(8-10)11-3-1-2-4-19-11/h7-9,11-12,18H,1-6H2 |
| InChIKey | BCBBNLHLZHWMOF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |