C7H14N2OS — CID 163983529
N-propan-2-yl-2-[[(Z)-2-sulfanylethenyl]amino]acetamide (PubChem CID 163983529) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is N-propan-2-yl-2-[[(Z)-2-sulfanylethenyl]amino]acetamide.
| Compound Name | N-propan-2-yl-2-[[(Z)-2-sulfanylethenyl]amino]acetamide |
|---|---|
| PubChem CID | 163983529 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-propan-2-yl-2-[[(Z)-2-sulfanylethenyl]amino]acetamide |
| SMILES | CC(C)NC(=O)CN/C=C\S |
| InChI | InChI=1S/C7H14N2OS/c1-6(2)9-7(10)5-8-3-4-11/h3-4,6,8,11H,5H2,1-2H3,(H,9,10)/b4-3- |
| InChIKey | TUIGDRKQOXNXEK-ARJAWSKDSA-N |
| XLogP | 0.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|