C9H14N2O2S — CID 115659300
N-butan-2-yl-2-(2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 115659300) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is N-butan-2-yl-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 115659300 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | N-butan-2-yl-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | CCC(C)NC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-3-7(2)10-8(12)6-11-4-5-14-9(11)13/h4-5,7H,3,6H2,1-2H3,(H,10,12) |
| InChIKey | DQZPGSWORGAMNF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |