C9H15N3OS — CID 146957017
(3-methyl-2H-1,3-thiazol-2-yl)-piperazin-1-ylmethanone (PubChem CID 146957017) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is (3-methyl-2H-1,3-thiazol-2-yl)-piperazin-1-ylmethanone.
| Compound Name | (3-methyl-2H-1,3-thiazol-2-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 146957017 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (3-methyl-2H-1,3-thiazol-2-yl)-piperazin-1-ylmethanone |
| SMILES | CN1C=CSC1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C9H15N3OS/c1-11-6-7-14-9(11)8(13)12-4-2-10-3-5-12/h6-7,9-10H,2-5H2,1H3 |
| InChIKey | AJVKTZGNHSMOAE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |