About 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone
2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone (PubChem CID 56994914) has the molecular formula C9H14N2OS2
and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone.
Molecular Properties
| Compound Name | 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone |
| PubChem CID | 56994914 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone |
| SMILES | O=C(CN1C=CSC1)N1CCSCC1 |
| InChI | InChI=1S/C9H14N2OS2/c12-9(7-10-1-4-14-8-10)11-2-5-13-6-3-11/h1,4H,2-3,5-8H2 |
| InChIKey | CHQOWYFRBXQIAP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone?
The IUPAC name of 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone (CID 56994914) is 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone.
What is the SMILES notation for 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone?
The canonical SMILES for 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone is O=C(CN1C=CSC1)N1CCSCC1.
What is the InChIKey of 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone?
The InChIKey is CHQOWYFRBXQIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS2/c12-9(7-10-1-4-14-8-10)11-2-5-13-6-3-11/h1,4H,2-3,5-8H2.
What are the key properties of 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone?
2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone has a molecular weight of 230.36 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-1,3-thiazol-3-yl)-1-thiomorpholin-4-ylethanone is sourced from PubChem (CID 56994914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).