C20H27N5O — CID 163985248
4-amino-7-[(3-ethylphenyl)methyl]-2-(pentylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 163985248) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-amino-7-[(3-ethylphenyl)methyl]-2-(pentylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-7-[(3-ethylphenyl)methyl]-2-(pentylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 163985248 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 4-amino-7-[(3-ethylphenyl)methyl]-2-(pentylamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCCNc1nc(N)c2c(n1)N(Cc1cccc(CC)c1)C(=O)C2 |
| InChI | InChI=1S/C20H27N5O/c1-3-5-6-10-22-20-23-18(21)16-12-17(26)25(19(16)24-20)13-15-9-7-8-14(4-2)11-15/h7-9,11H,3-6,10,12-13H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | ANMAEJCJEWHGRM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|