C26H19F4N3O2S2 — CID 163986553
4-[3-[2-fluoro-4-(4-methylsulfanyloxyphenyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 163986553) has the molecular formula C26H19F4N3O2S2 and a molecular weight of 545.58 g/mol. Its IUPAC name is 4-[3-[2-fluoro-4-(4-methylsulfanyloxyphenyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[2-fluoro-4-(4-methylsulfanyloxyphenyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 163986553 |
| Molecular Formula | C26H19F4N3O2S2 |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 4-[3-[2-fluoro-4-(4-methylsulfanyloxyphenyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CSOc1ccc(-c2ccc(N3C(=S)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)C3(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C26H19F4N3O2S2/c1-25(2)23(34)32(18-8-4-17(14-31)20(13-18)26(28,29)30)24(36)33(25)22-11-7-16(12-21(22)27)15-5-9-19(10-6-15)35-37-3/h4-13H,1-3H3 |
| InChIKey | TWWCWJLQIQJEGV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|