C19H18ClN5O2 — CID 163986735
2-(4-chlorophenyl)-2-methyl-5-methylidene-1-[(E)-2-(pyrimidin-4-ylamino)but-2-enoyl]imidazolidin-4-one (PubChem CID 163986735) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-5-methylidene-1-[(E)-2-(pyrimidin-4-ylamino)but-2-enoyl]imidazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-5-methylidene-1-[(E)-2-(pyrimidin-4-ylamino)but-2-enoyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 163986735 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-5-methylidene-1-[(E)-2-(pyrimidin-4-ylamino)but-2-enoyl]imidazolidin-4-one |
| SMILES | C=C1C(=O)NC(C)(c2ccc(Cl)cc2)N1C(=O)/C(=C\C)Nc1ccncn1 |
| InChI | InChI=1S/C19H18ClN5O2/c1-4-15(23-16-9-10-21-11-22-16)18(27)25-12(2)17(26)24-19(25,3)13-5-7-14(20)8-6-13/h4-11H,2H2,1,3H3,(H,24,26)(H,21,22,23)/b15-4+ |
| InChIKey | TWZPFYCIEHHROR-SYZQJQIISA-N |
| XLogP | 2.79 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|