C16H13BrF3N3O — CID 163987214
2-[4-amino-2-methyl-6-(trifluoromethyl)phenyl]-6-bromo-4-methyl-1,3-benzoxazol-5-amine (PubChem CID 163987214) has the molecular formula C16H13BrF3N3O and a molecular weight of 400.20 g/mol. Its IUPAC name is 2-[4-amino-2-methyl-6-(trifluoromethyl)phenyl]-6-bromo-4-methyl-1,3-benzoxazol-5-amine.
| Compound Name | 2-[4-amino-2-methyl-6-(trifluoromethyl)phenyl]-6-bromo-4-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 163987214 |
| Molecular Formula | C16H13BrF3N3O |
| Molecular Weight | 400.20 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[4-amino-2-methyl-6-(trifluoromethyl)phenyl]-6-bromo-4-methyl-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(N)cc(C(F)(F)F)c1-c1nc2c(C)c(N)c(Br)cc2o1 |
| InChI | InChI=1S/C16H13BrF3N3O/c1-6-3-8(21)4-9(16(18,19)20)12(6)15-23-14-7(2)13(22)10(17)5-11(14)24-15/h3-5H,21-22H2,1-2H3 |
| InChIKey | NFCVTFOZWCNYGP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|