C14H18O3 — CID 163988764
(1S,7R,8S,9R)-7-methyl-4,6,16-trioxapentacyclo[7.6.1.02,8.03,5.010,15]hexadec-10(15)-ene (PubChem CID 163988764) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1S,7R,8S,9R)-7-methyl-4,6,16-trioxapentacyclo[7.6.1.02,8.03,5.010,15]hexadec-10(15)-ene.
| Compound Name | (1S,7R,8S,9R)-7-methyl-4,6,16-trioxapentacyclo[7.6.1.02,8.03,5.010,15]hexadec-10(15)-ene |
|---|---|
| PubChem CID | 163988764 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1S,7R,8S,9R)-7-methyl-4,6,16-trioxapentacyclo[7.6.1.02,8.03,5.010,15]hexadec-10(15)-ene |
| SMILES | C[C@H]1OC2OC2C2C1[C@H]1O[C@@H]2C2=C1CCCC2 |
| InChI | InChI=1S/C14H18O3/c1-6-9-10(13-14(15-6)17-13)12-8-5-3-2-4-7(8)11(9)16-12/h6,9-14H,2-5H2,1H3/t6-,9?,10?,11+,12-,13?,14?/m1/s1 |
| InChIKey | TYRPWLLFRPBGJS-VWSQTDBGSA-N |
| XLogP | 2.01 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|