C12H16O3 — CID 10679881
(1R,7R,10R,12S,13S,14S)-12-methyl-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-4-ene (PubChem CID 10679881) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1R,7R,10R,12S,13S,14S)-12-methyl-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-4-ene.
| Compound Name | (1R,7R,10R,12S,13S,14S)-12-methyl-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-4-ene |
|---|---|
| PubChem CID | 10679881 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1R,7R,10R,12S,13S,14S)-12-methyl-2,9,11-trioxatetracyclo[5.5.2.04,13.010,14]tetradec-4-ene |
| SMILES | C[C@@H]1O[C@H]2OC[C@@H]3CC=C4CO[C@@H]1[C@H]4[C@H]32 |
| InChI | InChI=1S/C12H16O3/c1-6-11-9-7(4-13-11)2-3-8-5-14-12(15-6)10(8)9/h2,6,8-12H,3-5H2,1H3/t6-,8-,9+,10-,11-,12+/m0/s1 |
| InChIKey | YJVWEKWIWBWVEL-SLJBQCTMSA-N |
| XLogP | 1.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|