C12H18O2 — CID 91748033
2,2,6-trimethyl-7,11-dioxatricyclo[6.2.1.01,6]undec-4-ene (PubChem CID 91748033) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,2,6-trimethyl-7,11-dioxatricyclo[6.2.1.01,6]undec-4-ene.
| Compound Name | 2,2,6-trimethyl-7,11-dioxatricyclo[6.2.1.01,6]undec-4-ene |
|---|---|
| PubChem CID | 91748033 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,2,6-trimethyl-7,11-dioxatricyclo[6.2.1.01,6]undec-4-ene |
| SMILES | CC1(C)CC=CC2(C)OC3CCC12O3 |
| InChI | InChI=1S/C12H18O2/c1-10(2)6-4-7-11(3)12(10)8-5-9(13-11)14-12/h4,7,9H,5-6,8H2,1-3H3 |
| InChIKey | DFJRLXSMMWWPFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|