C21H32O3 — CID 163188203
(4R,7R,8S,15S)-2-methoxy-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-diene (PubChem CID 163188203) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (4R,7R,8S,15S)-2-methoxy-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-diene.
| Compound Name | (4R,7R,8S,15S)-2-methoxy-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-diene |
|---|---|
| PubChem CID | 163188203 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (4R,7R,8S,15S)-2-methoxy-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-diene |
| SMILES | COC1O[C@H]2OC[C@H](CCC=C(C)C)[C@@H]3CCC(C)=CCC=C1[C@@H]23 |
| InChI | InChI=1S/C21H32O3/c1-14(2)7-5-9-16-13-23-21-19-17(16)12-11-15(3)8-6-10-18(19)20(22-4)24-21/h7-8,10,16-17,19-21H,5-6,9,11-13H2,1-4H3/t16-,17-,19-,20?,21+/m0/s1 |
| InChIKey | KAYSVGOCNJQKMY-JXSCGJPBSA-N |
| XLogP | 5.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|