C20H30O3 — CID 163114660
(1E,2R,4R,7R,8S,11E,15S)-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-dien-2-ol (PubChem CID 163114660) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1E,2R,4R,7R,8S,11E,15S)-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-dien-2-ol.
| Compound Name | (1E,2R,4R,7R,8S,11E,15S)-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-dien-2-ol |
|---|---|
| PubChem CID | 163114660 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1E,2R,4R,7R,8S,11E,15S)-11-methyl-7-(4-methylpent-3-enyl)-3,5-dioxatricyclo[6.6.1.04,15]pentadeca-1(14),11-dien-2-ol |
| SMILES | CC(C)=CCC[C@H]1CO[C@@H]2O[C@@H](O)/C3=C/C/C=C(\C)CC[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C20H30O3/c1-13(2)6-4-8-15-12-22-20-18-16(15)11-10-14(3)7-5-9-17(18)19(21)23-20/h6-7,9,15-16,18-21H,4-5,8,10-12H2,1-3H3/b14-7+,17-9+/t15-,16-,18-,19+,20+/m0/s1 |
| InChIKey | VXBAUFFBFVAKFK-GUYCCTSGSA-N |
| XLogP | 4.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|